C19H18FN3O5 — CID 133422420
methyl 2-[[4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrobenzoyl]amino]acetate (PubChem CID 133422420) has the molecular formula C19H18FN3O5 and a molecular weight of 387.37 g/mol. Its IUPAC name is methyl 2-[[4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrobenzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrobenzoyl]amino]acetate |
|---|---|
| PubChem CID | 133422420 |
| Molecular Formula | C19H18FN3O5 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | methyl 2-[[4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrobenzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(N2CCc3cc(F)ccc3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18FN3O5/c1-28-18(24)10-21-19(25)13-3-5-16(17(9-13)23(26)27)22-7-6-12-8-15(20)4-2-14(12)11-22/h2-5,8-9H,6-7,10-11H2,1H3,(H,21,25) |
| InChIKey | NLIGFUSPWKZDIK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|