C17H15FN2O4 — CID 133422285
methyl 5-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2-nitrobenzoate (PubChem CID 133422285) has the molecular formula C17H15FN2O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is methyl 5-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2-nitrobenzoate.
| Compound Name | methyl 5-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2-nitrobenzoate |
|---|---|
| PubChem CID | 133422285 |
| Molecular Formula | C17H15FN2O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | methyl 5-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(N2CCc3cc(F)ccc3C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15FN2O4/c1-24-17(21)15-9-14(4-5-16(15)20(22)23)19-7-6-11-8-13(18)3-2-12(11)10-19/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | SOMGXDXBNBSKBZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|