C18H16N2O6 — CID 59806885
dimethyl 4-(5-nitro-1,3-dihydroisoindol-2-yl)benzene-1,2-dicarboxylate (PubChem CID 59806885) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is dimethyl 4-(5-nitro-1,3-dihydroisoindol-2-yl)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(5-nitro-1,3-dihydroisoindol-2-yl)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59806885 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | dimethyl 4-(5-nitro-1,3-dihydroisoindol-2-yl)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(N2Cc3ccc([N+](=O)[O-])cc3C2)cc1C(=O)OC |
| InChI | InChI=1S/C18H16N2O6/c1-25-17(21)15-6-5-13(8-16(15)18(22)26-2)19-9-11-3-4-14(20(23)24)7-12(11)10-19/h3-8H,9-10H2,1-2H3 |
| InChIKey | RERJKNOPGRGYFV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|