C19H18N4O4 — CID 136611537
2-[5-(3-nitro-4-piperidin-1-ylphenyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 136611537) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is 2-[5-(3-nitro-4-piperidin-1-ylphenyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 2-[5-(3-nitro-4-piperidin-1-ylphenyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 136611537 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[5-(3-nitro-4-piperidin-1-ylphenyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | O=[N+]([O-])c1cc(-c2nc(-c3ccccc3O)no2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C19H18N4O4/c24-17-7-3-2-6-14(17)18-20-19(27-21-18)13-8-9-15(16(12-13)23(25)26)22-10-4-1-5-11-22/h2-3,6-9,12,24H,1,4-5,10-11H2 |
| InChIKey | WJRONESOOFPZFL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|