C19H15F3N4O5 — CID 25256077
4-[2-nitro-4-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]morpholine (PubChem CID 25256077) has the molecular formula C19H15F3N4O5 and a molecular weight of 436.35 g/mol. Its IUPAC name is 4-[2-nitro-4-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]morpholine.
| Compound Name | 4-[2-nitro-4-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 25256077 |
| Molecular Formula | C19H15F3N4O5 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 4-[2-nitro-4-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]morpholine |
| SMILES | O=[N+]([O-])c1cc(-c2nc(-c3ccccc3OC(F)(F)F)no2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H15F3N4O5/c20-19(21,22)30-16-4-2-1-3-13(16)17-23-18(31-24-17)12-5-6-14(15(11-12)26(27)28)25-7-9-29-10-8-25/h1-6,11H,7-10H2 |
| InChIKey | DPZNBIKTHLTMDS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 103.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|