C23H23N5O3 — CID 124567731
3-(1-methylindol-5-yl)-5-[4-[(2R)-2-methylpiperidin-1-yl]-3-nitrophenyl]-1,2,4-oxadiazole (PubChem CID 124567731) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-(1-methylindol-5-yl)-5-[4-[(2R)-2-methylpiperidin-1-yl]-3-nitrophenyl]-1,2,4-oxadiazole.
| Compound Name | 3-(1-methylindol-5-yl)-5-[4-[(2R)-2-methylpiperidin-1-yl]-3-nitrophenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 124567731 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-(1-methylindol-5-yl)-5-[4-[(2R)-2-methylpiperidin-1-yl]-3-nitrophenyl]-1,2,4-oxadiazole |
| SMILES | C[C@@H]1CCCCN1c1ccc(-c2nc(-c3ccc4c(ccn4C)c3)no2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23N5O3/c1-15-5-3-4-11-27(15)20-9-7-18(14-21(20)28(29)30)23-24-22(25-31-23)17-6-8-19-16(13-17)10-12-26(19)2/h6-10,12-15H,3-5,11H2,1-2H3/t15-/m1/s1 |
| InChIKey | BUFMYNUIMIZENG-OAHLLOKOSA-N |
| XLogP | 5.18 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|