C24H22N6O3 — CID 46263686
3-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-5-pyridin-3-yl-1,2,4-oxadiazole (PubChem CID 46263686) has the molecular formula C24H22N6O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is 3-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-5-pyridin-3-yl-1,2,4-oxadiazole.
| Compound Name | 3-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-5-pyridin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46263686 |
| Molecular Formula | C24H22N6O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-[4-(4-benzylpiperazin-1-yl)-3-nitrophenyl]-5-pyridin-3-yl-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(-c2noc(-c3cccnc3)n2)ccc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H22N6O3/c31-30(32)22-15-19(23-26-24(33-27-23)20-7-4-10-25-16-20)8-9-21(22)29-13-11-28(12-14-29)17-18-5-2-1-3-6-18/h1-10,15-16H,11-14,17H2 |
| InChIKey | PICGSWAGDIQUEL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 101.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|