C14H10N4O4 — CID 2183720
5-(4-methoxy-3-nitrophenyl)-3-pyridin-2-yl-1,2,4-oxadiazole (PubChem CID 2183720) has the molecular formula C14H10N4O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is 5-(4-methoxy-3-nitrophenyl)-3-pyridin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(4-methoxy-3-nitrophenyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2183720 |
| Molecular Formula | C14H10N4O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 5-(4-methoxy-3-nitrophenyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2nc(-c3ccccn3)no2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10N4O4/c1-21-12-6-5-9(8-11(12)18(19)20)14-16-13(17-22-14)10-4-2-3-7-15-10/h2-8H,1H3 |
| InChIKey | LBNAMSJRCZMDFU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 104.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|