C10H9N3O4 — CID 616601
3-(4-methoxy-3-nitrophenyl)-5-methyl-1,2,4-oxadiazole (PubChem CID 616601) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-(4-methoxy-3-nitrophenyl)-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-(4-methoxy-3-nitrophenyl)-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 616601 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-(4-methoxy-3-nitrophenyl)-5-methyl-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(C)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N3O4/c1-6-11-10(12-17-6)7-3-4-9(16-2)8(5-7)13(14)15/h3-5H,1-2H3 |
| InChIKey | FEEHDLGDXXYORB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|