C22H15N3O5 — CID 18197474
[4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrophenyl]-phenylmethanone (PubChem CID 18197474) has the molecular formula C22H15N3O5 and a molecular weight of 401.38 g/mol. Its IUPAC name is [4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrophenyl]-phenylmethanone.
| Compound Name | [4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 18197474 |
| Molecular Formula | C22H15N3O5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrophenyl]-phenylmethanone |
| SMILES | Cc1nc(-c2ccc(Oc3ccc(C(=O)c4ccccc4)cc3[N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C22H15N3O5/c1-14-23-22(24-30-14)16-7-10-18(11-8-16)29-20-12-9-17(13-19(20)25(27)28)21(26)15-5-3-2-4-6-15/h2-13H,1H3 |
| InChIKey | MBNUEJSSTDXUPY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|