C16H10F3N3O6S — CID 60503233
5-methyl-3-[3-[2-nitro-4-(trifluoromethylsulfonyl)phenoxy]phenyl]-1,2,4-oxadiazole (PubChem CID 60503233) has the molecular formula C16H10F3N3O6S and a molecular weight of 429.33 g/mol. Its IUPAC name is 5-methyl-3-[3-[2-nitro-4-(trifluoromethylsulfonyl)phenoxy]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-methyl-3-[3-[2-nitro-4-(trifluoromethylsulfonyl)phenoxy]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 60503233 |
| Molecular Formula | C16H10F3N3O6S |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 5-methyl-3-[3-[2-nitro-4-(trifluoromethylsulfonyl)phenoxy]phenyl]-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2cccc(Oc3ccc(S(=O)(=O)C(F)(F)F)cc3[N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C16H10F3N3O6S/c1-9-20-15(21-28-9)10-3-2-4-11(7-10)27-14-6-5-12(8-13(14)22(23)24)29(25,26)16(17,18)19/h2-8H,1H3 |
| InChIKey | WPNBLMVAGPDOLP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 125.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|