C16H14N4O4 — CID 172677976
5-methoxy-N-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-nitroaniline (PubChem CID 172677976) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is 5-methoxy-N-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-nitroaniline.
| Compound Name | 5-methoxy-N-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-nitroaniline |
|---|---|
| PubChem CID | 172677976 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 5-methoxy-N-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-nitroaniline |
| SMILES | COc1ccc([N+](=O)[O-])c(Nc2cccc(-c3noc(C)n3)c2)c1 |
| InChI | InChI=1S/C16H14N4O4/c1-10-17-16(19-24-10)11-4-3-5-12(8-11)18-14-9-13(23-2)6-7-15(14)20(21)22/h3-9,18H,1-2H3 |
| InChIKey | LRYBGRKBRMZGDD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|