C10H8BrN3O4 — CID 79555784
4-bromo-5-(4-methoxy-3-nitrophenyl)-1,2-oxazol-3-amine (PubChem CID 79555784) has the molecular formula C10H8BrN3O4 and a molecular weight of 314.10 g/mol. Its IUPAC name is 4-bromo-5-(4-methoxy-3-nitrophenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-bromo-5-(4-methoxy-3-nitrophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 79555784 |
| Molecular Formula | C10H8BrN3O4 |
| Molecular Weight | 314.10 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 4-bromo-5-(4-methoxy-3-nitrophenyl)-1,2-oxazol-3-amine |
| SMILES | COc1ccc(-c2onc(N)c2Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8BrN3O4/c1-17-7-3-2-5(4-6(7)14(15)16)9-8(11)10(12)13-18-9/h2-4H,1H3,(H2,12,13) |
| InChIKey | NIHOBBBWJYJNEO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.10 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|