C21H16N2O5 — CID 150184230
5-(4-methoxynaphthalen-1-yl)-4-(4-methoxy-3-nitrophenyl)-1,2-oxazole (PubChem CID 150184230) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is 5-(4-methoxynaphthalen-1-yl)-4-(4-methoxy-3-nitrophenyl)-1,2-oxazole.
| Compound Name | 5-(4-methoxynaphthalen-1-yl)-4-(4-methoxy-3-nitrophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 150184230 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 5-(4-methoxynaphthalen-1-yl)-4-(4-methoxy-3-nitrophenyl)-1,2-oxazole |
| SMILES | COc1ccc(-c2cnoc2-c2ccc(OC)c3ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N2O5/c1-26-19-10-8-16(14-5-3-4-6-15(14)19)21-17(12-22-28-21)13-7-9-20(27-2)18(11-13)23(24)25/h3-12H,1-2H3 |
| InChIKey | FMBJVDQVVZOLQU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 87.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|