C26H25N3O8 — CID 126639862
2-methoxy-N-[(4-nitrophenoxy)methyl]-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]aniline (PubChem CID 126639862) has the molecular formula C26H25N3O8 and a molecular weight of 507.50 g/mol. Its IUPAC name is 2-methoxy-N-[(4-nitrophenoxy)methyl]-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]aniline.
| Compound Name | 2-methoxy-N-[(4-nitrophenoxy)methyl]-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]aniline |
|---|---|
| PubChem CID | 126639862 |
| Molecular Formula | C26H25N3O8 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 2-methoxy-N-[(4-nitrophenoxy)methyl]-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]aniline |
| SMILES | COc1ccc(-c2cnoc2-c2cc(OC)c(OC)c(OC)c2)cc1NCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H25N3O8/c1-32-22-10-5-16(11-21(22)27-15-36-19-8-6-18(7-9-19)29(30)31)20-14-28-37-25(20)17-12-23(33-2)26(35-4)24(13-17)34-3/h5-14,27H,15H2,1-4H3 |
| InChIKey | CXGKHELBOUZABA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|