C25H30ClN3O6 — CID 141302166
3-amino-2-chloro-N-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl]-4-methylpentanamide (PubChem CID 141302166) has the molecular formula C25H30ClN3O6 and a molecular weight of 503.98 g/mol. Its IUPAC name is 3-amino-2-chloro-N-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl]-4-methylpentanamide.
| Compound Name | 3-amino-2-chloro-N-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 141302166 |
| Molecular Formula | C25H30ClN3O6 |
| Molecular Weight | 503.98 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 3-amino-2-chloro-N-[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]phenyl]-4-methylpentanamide |
| SMILES | COc1ccc(-c2cnoc2-c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)C(Cl)C(N)C(C)C |
| InChI | InChI=1S/C25H30ClN3O6/c1-13(2)22(27)21(26)25(30)29-17-9-14(7-8-18(17)31-3)16-12-28-35-23(16)15-10-19(32-4)24(34-6)20(11-15)33-5/h7-13,21-22H,27H2,1-6H3,(H,29,30) |
| InChIKey | OTLGFWVRQKHSCO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 118.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|