C25H33ClN4O4 — CID 123184630
[6-amino-1-[2-methoxy-5-[5-(3-methoxy-4,5-dimethylphenyl)-1,2-oxazol-4-yl]anilino]-1-oxohexan-2-yl]azanium chloride (PubChem CID 123184630) has the molecular formula C25H33ClN4O4 and a molecular weight of 489.02 g/mol. Its IUPAC name is [6-amino-1-[2-methoxy-5-[5-(3-methoxy-4,5-dimethylphenyl)-1,2-oxazol-4-yl]anilino]-1-oxohexan-2-yl]azanium chloride.
| Compound Name | [6-amino-1-[2-methoxy-5-[5-(3-methoxy-4,5-dimethylphenyl)-1,2-oxazol-4-yl]anilino]-1-oxohexan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 123184630 |
| Molecular Formula | C25H33ClN4O4 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | [6-amino-1-[2-methoxy-5-[5-(3-methoxy-4,5-dimethylphenyl)-1,2-oxazol-4-yl]anilino]-1-oxohexan-2-yl]azanium chloride |
| SMILES | COc1ccc(-c2cnoc2-c2cc(C)c(C)c(OC)c2)cc1NC(=O)C([NH3+])CCCCN.[Cl-] |
| InChI | InChI=1S/C25H32N4O4.ClH/c1-15-11-18(13-23(32-4)16(15)2)24-19(14-28-33-24)17-8-9-22(31-3)21(12-17)29-25(30)20(27)7-5-6-10-26;/h8-9,11-14,20H,5-7,10,26-27H2,1-4H3,(H,29,30);1H |
| InChIKey | VACCAMRNFRSZBU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|