C15H10N4O6 — CID 17171729
2-(4-methoxy-3-nitrophenyl)-5-(3-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 17171729) has the molecular formula C15H10N4O6 and a molecular weight of 342.27 g/mol. Its IUPAC name is 2-(4-methoxy-3-nitrophenyl)-5-(3-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(4-methoxy-3-nitrophenyl)-5-(3-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 17171729 |
| Molecular Formula | C15H10N4O6 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-(4-methoxy-3-nitrophenyl)-5-(3-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | COc1ccc(-c2nnc(-c3cccc([N+](=O)[O-])c3)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10N4O6/c1-24-13-6-5-10(8-12(13)19(22)23)15-17-16-14(25-15)9-3-2-4-11(7-9)18(20)21/h2-8H,1H3 |
| InChIKey | HMJNZEZBOZEUBC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 134.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|