C17H19NO6 — CID 90953936
1-(4-ethoxy-3-nitrophenyl)-2,3,4-trimethoxybenzene (PubChem CID 90953936) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 1-(4-ethoxy-3-nitrophenyl)-2,3,4-trimethoxybenzene.
| Compound Name | 1-(4-ethoxy-3-nitrophenyl)-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 90953936 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-(4-ethoxy-3-nitrophenyl)-2,3,4-trimethoxybenzene |
| SMILES | CCOc1ccc(-c2ccc(OC)c(OC)c2OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19NO6/c1-5-24-14-8-6-11(10-13(14)18(19)20)12-7-9-15(21-2)17(23-4)16(12)22-3/h6-10H,5H2,1-4H3 |
| InChIKey | LIACAKZXZDTEGI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|