C19H21NO8 — CID 21255393
ethyl 6-(4,5-dimethoxy-2-nitrophenyl)-2,3-dimethoxybenzoate (PubChem CID 21255393) has the molecular formula C19H21NO8 and a molecular weight of 391.38 g/mol. Its IUPAC name is ethyl 6-(4,5-dimethoxy-2-nitrophenyl)-2,3-dimethoxybenzoate.
| Compound Name | ethyl 6-(4,5-dimethoxy-2-nitrophenyl)-2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 21255393 |
| Molecular Formula | C19H21NO8 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | ethyl 6-(4,5-dimethoxy-2-nitrophenyl)-2,3-dimethoxybenzoate |
| SMILES | CCOC(=O)c1c(-c2cc(OC)c(OC)cc2[N+](=O)[O-])ccc(OC)c1OC |
| InChI | InChI=1S/C19H21NO8/c1-6-28-19(21)17-11(7-8-14(24-2)18(17)27-5)12-9-15(25-3)16(26-4)10-13(12)20(22)23/h7-10H,6H2,1-5H3 |
| InChIKey | LJCAUSWPZDQADN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|