C11H13NO7 — CID 623208
methyl 2,3,4-trimethoxy-6-nitrobenzoate (PubChem CID 623208) has the molecular formula C11H13NO7 and a molecular weight of 271.22 g/mol. Its IUPAC name is methyl 2,3,4-trimethoxy-6-nitrobenzoate.
| Compound Name | methyl 2,3,4-trimethoxy-6-nitrobenzoate |
|---|---|
| PubChem CID | 623208 |
| Molecular Formula | C11H13NO7 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | methyl 2,3,4-trimethoxy-6-nitrobenzoate |
| SMILES | COC(=O)c1c([N+](=O)[O-])cc(OC)c(OC)c1OC |
| InChI | InChI=1S/C11H13NO7/c1-16-7-5-6(12(14)15)8(11(13)19-4)10(18-3)9(7)17-2/h5H,1-4H3 |
| InChIKey | MEUXGIGBLQIBSC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|