C19H21NO6 — CID 22671380
(2,6-dimethyl-3-nitrophenyl)-(2,3,4-trimethoxy-6-methylphenyl)methanone (PubChem CID 22671380) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is (2,6-dimethyl-3-nitrophenyl)-(2,3,4-trimethoxy-6-methylphenyl)methanone.
| Compound Name | (2,6-dimethyl-3-nitrophenyl)-(2,3,4-trimethoxy-6-methylphenyl)methanone |
|---|---|
| PubChem CID | 22671380 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (2,6-dimethyl-3-nitrophenyl)-(2,3,4-trimethoxy-6-methylphenyl)methanone |
| SMILES | COc1cc(C)c(C(=O)c2c(C)ccc([N+](=O)[O-])c2C)c(OC)c1OC |
| InChI | InChI=1S/C19H21NO6/c1-10-7-8-13(20(22)23)12(3)15(10)17(21)16-11(2)9-14(24-4)18(25-5)19(16)26-6/h7-9H,1-6H3 |
| InChIKey | XMILMPUBPHAMEK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|