C20H22O6 — CID 22671378
[3-methyl-2-(2,3,4-trimethoxy-6-methylbenzoyl)phenyl] acetate (PubChem CID 22671378) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is [3-methyl-2-(2,3,4-trimethoxy-6-methylbenzoyl)phenyl] acetate.
| Compound Name | [3-methyl-2-(2,3,4-trimethoxy-6-methylbenzoyl)phenyl] acetate |
|---|---|
| PubChem CID | 22671378 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [3-methyl-2-(2,3,4-trimethoxy-6-methylbenzoyl)phenyl] acetate |
| SMILES | COc1cc(C)c(C(=O)c2c(C)cccc2OC(C)=O)c(OC)c1OC |
| InChI | InChI=1S/C20H22O6/c1-11-8-7-9-14(26-13(3)21)16(11)18(22)17-12(2)10-15(23-4)19(24-5)20(17)25-6/h7-10H,1-6H3 |
| InChIKey | BQVGIWDSOHVKIU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|