C34H37BrO8 — CID 158614208
benzoyl bromide;phenyl-(2,3,4-trimethoxy-6-methylphenyl)methanone;1,2,3-trimethoxy-5-methylbenzene (PubChem CID 158614208) has the molecular formula C34H37BrO8 and a molecular weight of 653.57 g/mol. Its IUPAC name is benzoyl bromide;phenyl-(2,3,4-trimethoxy-6-methylphenyl)methanone;1,2,3-trimethoxy-5-methylbenzene.
| Compound Name | benzoyl bromide;phenyl-(2,3,4-trimethoxy-6-methylphenyl)methanone;1,2,3-trimethoxy-5-methylbenzene |
|---|---|
| PubChem CID | 158614208 |
| Molecular Formula | C34H37BrO8 |
| Molecular Weight | 653.57 g/mol |
| Exact Mass | 652.17 |
| IUPAC Name | benzoyl bromide;phenyl-(2,3,4-trimethoxy-6-methylphenyl)methanone;1,2,3-trimethoxy-5-methylbenzene |
| SMILES | COc1cc(C)c(C(=O)c2ccccc2)c(OC)c1OC.COc1cc(C)cc(OC)c1OC.O=C(Br)c1ccccc1 |
| InChI | InChI=1S/C17H18O4.C10H14O3.C7H5BrO/c1-11-10-13(19-2)16(20-3)17(21-4)14(11)15(18)12-8-6-5-7-9-12;1-7-5-8(11-2)10(13-4)9(6-7)12-3;8-7(9)6-4-2-1-3-5-6/h5-10H,1-4H3;5-6H,1-4H3;1-5H |
| InChIKey | HXESKEAZAHWTLQ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.57 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|