C25H24BrO5P — CID 70013466
[(3-bromo-2,6-dimethoxyphenyl)-(2,4,6-trimethylbenzoyl)phosphoryl]-phenylmethanone (PubChem CID 70013466) has the molecular formula C25H24BrO5P and a molecular weight of 515.34 g/mol. Its IUPAC name is [(3-bromo-2,6-dimethoxyphenyl)-(2,4,6-trimethylbenzoyl)phosphoryl]-phenylmethanone.
| Compound Name | [(3-bromo-2,6-dimethoxyphenyl)-(2,4,6-trimethylbenzoyl)phosphoryl]-phenylmethanone |
|---|---|
| PubChem CID | 70013466 |
| Molecular Formula | C25H24BrO5P |
| Molecular Weight | 515.34 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | [(3-bromo-2,6-dimethoxyphenyl)-(2,4,6-trimethylbenzoyl)phosphoryl]-phenylmethanone |
| SMILES | COc1ccc(Br)c(OC)c1P(=O)(C(=O)c1ccccc1)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H24BrO5P/c1-15-13-16(2)21(17(3)14-15)25(28)32(29,24(27)18-9-7-6-8-10-18)23-20(30-4)12-11-19(26)22(23)31-5/h6-14H,1-5H3 |
| InChIKey | WBKYAWCNIKZCCN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.34 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|