C24H25O3P — CID 18983505
[(2,4-dimethylphenoxy)-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 18983505) has the molecular formula C24H25O3P and a molecular weight of 392.44 g/mol. Its IUPAC name is [(2,4-dimethylphenoxy)-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [(2,4-dimethylphenoxy)-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 18983505 |
| Molecular Formula | C24H25O3P |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [(2,4-dimethylphenoxy)-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1ccc(OP(=O)(C(=O)c2c(C)cc(C)cc2C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H25O3P/c1-16-11-12-22(18(3)13-16)27-28(26,21-9-7-6-8-10-21)24(25)23-19(4)14-17(2)15-20(23)5/h6-15H,1-5H3 |
| InChIKey | SDZGVKPDBSXVSN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|