C34H29O2P — CID 162462409
bis(4-phenylphenyl)phosphoryl-(2,4,6-trimethylphenyl)methanone (PubChem CID 162462409) has the molecular formula C34H29O2P and a molecular weight of 500.58 g/mol. Its IUPAC name is bis(4-phenylphenyl)phosphoryl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | bis(4-phenylphenyl)phosphoryl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 162462409 |
| Molecular Formula | C34H29O2P |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | bis(4-phenylphenyl)phosphoryl-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C34H29O2P/c1-24-22-25(2)33(26(3)23-24)34(35)37(36,31-18-14-29(15-19-31)27-10-6-4-7-11-27)32-20-16-30(17-21-32)28-12-8-5-9-13-28/h4-23H,1-3H3 |
| InChIKey | VRWCUNRXRCRTPV-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|