C36H33O4P — CID 175015018
diphenylphosphoryl(phenyl)methanone;2-hydroxy-2-phenyl-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 175015018) has the molecular formula C36H33O4P and a molecular weight of 560.63 g/mol. Its IUPAC name is diphenylphosphoryl(phenyl)methanone;2-hydroxy-2-phenyl-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | diphenylphosphoryl(phenyl)methanone;2-hydroxy-2-phenyl-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 175015018 |
| Molecular Formula | C36H33O4P |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | diphenylphosphoryl(phenyl)methanone;2-hydroxy-2-phenyl-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)C(O)c2ccccc2)c(C)c1.O=C(c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H15O2P.C17H18O2/c20-19(16-10-4-1-5-11-16)22(21,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-11-9-12(2)15(13(3)10-11)17(19)16(18)14-7-5-4-6-8-14/h1-15H;4-10,16,18H,1-3H3 |
| InChIKey | SKQGKUCZDOJLGU-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|