C36H37O7P — CID 90252962
[4-[3-bis(2,4,6-trimethylbenzoyl)phosphoryloxy-2-hydroxypropoxy]phenyl]-phenylmethanone (PubChem CID 90252962) has the molecular formula C36H37O7P and a molecular weight of 612.66 g/mol. Its IUPAC name is [4-[3-bis(2,4,6-trimethylbenzoyl)phosphoryloxy-2-hydroxypropoxy]phenyl]-phenylmethanone.
| Compound Name | [4-[3-bis(2,4,6-trimethylbenzoyl)phosphoryloxy-2-hydroxypropoxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 90252962 |
| Molecular Formula | C36H37O7P |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | [4-[3-bis(2,4,6-trimethylbenzoyl)phosphoryloxy-2-hydroxypropoxy]phenyl]-phenylmethanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(OCC(O)COc2ccc(C(=O)c3ccccc3)cc2)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C36H37O7P/c1-22-16-24(3)32(25(4)17-22)35(39)44(41,36(40)33-26(5)18-23(2)19-27(33)6)43-21-30(37)20-42-31-14-12-29(13-15-31)34(38)28-10-8-7-9-11-28/h7-19,30,37H,20-21H2,1-6H3 |
| InChIKey | UAHIHDGMAYOTIB-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|