C22H21O2PS — CID 88978120
[2,6-dimethyl-4-(sulfanylmethyl)phenyl]-diphenylphosphorylmethanone (PubChem CID 88978120) has the molecular formula C22H21O2PS and a molecular weight of 380.45 g/mol. Its IUPAC name is [2,6-dimethyl-4-(sulfanylmethyl)phenyl]-diphenylphosphorylmethanone.
| Compound Name | [2,6-dimethyl-4-(sulfanylmethyl)phenyl]-diphenylphosphorylmethanone |
|---|---|
| PubChem CID | 88978120 |
| Molecular Formula | C22H21O2PS |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [2,6-dimethyl-4-(sulfanylmethyl)phenyl]-diphenylphosphorylmethanone |
| SMILES | Cc1cc(CS)cc(C)c1C(=O)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21O2PS/c1-16-13-18(15-26)14-17(2)21(16)22(23)25(24,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-14,26H,15H2,1-2H3 |
| InChIKey | IORHAQLMVIXSMP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|