C44H46O8P2 — CID 23499722
biphenylene;bis(bis(2,4-dimethylphenyl) hydrogen phosphate) (PubChem CID 23499722) has the molecular formula C44H46O8P2 and a molecular weight of 764.79 g/mol. Its IUPAC name is biphenylene;bis(bis(2,4-dimethylphenyl) hydrogen phosphate).
| Compound Name | biphenylene;bis(bis(2,4-dimethylphenyl) hydrogen phosphate) |
|---|---|
| PubChem CID | 23499722 |
| Molecular Formula | C44H46O8P2 |
| Molecular Weight | 764.79 g/mol |
| Exact Mass | 764.27 |
| IUPAC Name | biphenylene;bis(bis(2,4-dimethylphenyl) hydrogen phosphate) |
| SMILES | Cc1ccc(OP(=O)(O)Oc2ccc(C)cc2C)c(C)c1.Cc1ccc(OP(=O)(O)Oc2ccc(C)cc2C)c(C)c1.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/2C16H19O4P.C12H8/c2*1-11-5-7-15(13(3)9-11)19-21(17,18)20-16-8-6-12(2)10-14(16)4;1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h2*5-10H,1-4H3,(H,17,18);1-8H |
| InChIKey | XFEPXXNTLUMRRV-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.79 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|