C35H35O6P — CID 158862858
[2-bis(2,4,6-trimethylbenzoyl)phosphorylphenyl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 158862858) has the molecular formula C35H35O6P and a molecular weight of 582.63 g/mol. Its IUPAC name is [2-bis(2,4,6-trimethylbenzoyl)phosphorylphenyl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [2-bis(2,4,6-trimethylbenzoyl)phosphorylphenyl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 158862858 |
| Molecular Formula | C35H35O6P |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | [2-bis(2,4,6-trimethylbenzoyl)phosphorylphenyl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)c1ccccc1P(=O)(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C35H35O6P/c1-20-16-22(3)30(23(4)17-20)34(37)42(39,35(38)31-24(5)18-21(2)19-25(31)6)29-15-10-9-12-26(29)33(36)32-27(40-7)13-11-14-28(32)41-8/h9-19H,1-8H3 |
| InChIKey | JAWAEYQKKPOLAT-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|