C18H21O5P — CID 69347540
ethyl [2-(2,4,6-trimethylbenzoyl)phenyl] hydrogen phosphate (PubChem CID 69347540) has the molecular formula C18H21O5P and a molecular weight of 348.34 g/mol. Its IUPAC name is ethyl [2-(2,4,6-trimethylbenzoyl)phenyl] hydrogen phosphate.
| Compound Name | ethyl [2-(2,4,6-trimethylbenzoyl)phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 69347540 |
| Molecular Formula | C18H21O5P |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | ethyl [2-(2,4,6-trimethylbenzoyl)phenyl] hydrogen phosphate |
| SMILES | CCOP(=O)(O)Oc1ccccc1C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C18H21O5P/c1-5-22-24(20,21)23-16-9-7-6-8-15(16)18(19)17-13(3)10-12(2)11-14(17)4/h6-11H,5H2,1-4H3,(H,20,21) |
| InChIKey | JKVARUSRBKZGGY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|