C20H23O4P — CID 66682263
(2,3-diethoxy-4-phosphorosophenyl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 66682263) has the molecular formula C20H23O4P and a molecular weight of 358.37 g/mol. Its IUPAC name is (2,3-diethoxy-4-phosphorosophenyl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (2,3-diethoxy-4-phosphorosophenyl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 66682263 |
| Molecular Formula | C20H23O4P |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2,3-diethoxy-4-phosphorosophenyl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCOc1c(P=O)ccc(C(=O)c2c(C)cc(C)cc2C)c1OCC |
| InChI | InChI=1S/C20H23O4P/c1-6-23-19-15(8-9-16(25-22)20(19)24-7-2)18(21)17-13(4)10-12(3)11-14(17)5/h8-11H,6-7H2,1-5H3 |
| InChIKey | UQSZRTOLARWNNX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|