C18H19O4P — CID 174779309
(2,6-dimethoxy-3-phosphorosophenyl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 174779309) has the molecular formula C18H19O4P and a molecular weight of 330.32 g/mol. Its IUPAC name is (2,6-dimethoxy-3-phosphorosophenyl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (2,6-dimethoxy-3-phosphorosophenyl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 174779309 |
| Molecular Formula | C18H19O4P |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (2,6-dimethoxy-3-phosphorosophenyl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | COc1ccc(P=O)c(OC)c1C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C18H19O4P/c1-10-8-11(2)15(12(3)9-10)17(19)16-13(21-4)6-7-14(23-20)18(16)22-5/h6-9H,1-5H3 |
| InChIKey | MJWUFSRXGOAEFF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|