C26H25O3P — CID 172735368
[2-phosphoroso-3-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 172735368) has the molecular formula C26H25O3P and a molecular weight of 416.46 g/mol. Its IUPAC name is [2-phosphoroso-3-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [2-phosphoroso-3-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 172735368 |
| Molecular Formula | C26H25O3P |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [2-phosphoroso-3-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2cccc(C(=O)c3c(C)cc(C)cc3C)c2P=O)c(C)c1 |
| InChI | InChI=1S/C26H25O3P/c1-14-10-16(3)22(17(4)11-14)24(27)20-8-7-9-21(26(20)30-29)25(28)23-18(5)12-15(2)13-19(23)6/h7-13H,1-6H3 |
| InChIKey | GZEBVOSFYYECRY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|