C16H18LiOP — CID 173243819
lithium;hydride;(2-phosphanylphenyl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 173243819) has the molecular formula C16H18LiOP and a molecular weight of 264.23 g/mol. Its IUPAC name is lithium;hydride;(2-phosphanylphenyl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | lithium;hydride;(2-phosphanylphenyl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 173243819 |
| Molecular Formula | C16H18LiOP |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | lithium;hydride;(2-phosphanylphenyl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2P)c(C)c1.[H-].[Li+] |
| InChI | InChI=1S/C16H17OP.Li.H/c1-10-8-11(2)15(12(3)9-10)16(17)13-6-4-5-7-14(13)18;;/h4-9H,18H2,1-3H3;;/q;+1;-1 |
| InChIKey | FHRPODYQXMYCBA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|