C21H19O2P — CID 174396027
(2,6-dimethylphenyl)-(5-phenoxy-2-phosphanylphenyl)methanone (PubChem CID 174396027) has the molecular formula C21H19O2P and a molecular weight of 334.36 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-(5-phenoxy-2-phosphanylphenyl)methanone.
| Compound Name | (2,6-dimethylphenyl)-(5-phenoxy-2-phosphanylphenyl)methanone |
|---|---|
| PubChem CID | 174396027 |
| Molecular Formula | C21H19O2P |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (2,6-dimethylphenyl)-(5-phenoxy-2-phosphanylphenyl)methanone |
| SMILES | Cc1cccc(C)c1C(=O)c1cc(Oc2ccccc2)ccc1P |
| InChI | InChI=1S/C21H19O2P/c1-14-7-6-8-15(2)20(14)21(22)18-13-17(11-12-19(18)24)23-16-9-4-3-5-10-16/h3-13H,24H2,1-2H3 |
| InChIKey | PNGNANXJAUNWHF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|