About lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone
lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone (PubChem CID 173244480) has the molecular formula C22H30LiOP
and a molecular weight of 348.40 g/mol. Its IUPAC name is lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone.
Molecular Properties
| Compound Name | lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone |
| PubChem CID | 173244480 |
| Molecular Formula | C22H30LiOP |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone |
| SMILES | CC(C)c1cc(C(C)C)c(C(=O)c2ccccc2P)c(C(C)C)c1.[H-].[Li+] |
| InChI | InChI=1S/C22H29OP.Li.H/c1-13(2)16-11-18(14(3)4)21(19(12-16)15(5)6)22(23)17-9-7-8-10-20(17)24;;/h7-15H,24H2,1-6H3;;/q;+1;-1 |
| InChIKey | SLFVEJLGDKQXCH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone?
The IUPAC name of lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone (CID 173244480) is lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone.
What is the SMILES notation for lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone?
The canonical SMILES for lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone is CC(C)c1cc(C(C)C)c(C(=O)c2ccccc2P)c(C(C)C)c1.[H-].[Li+].
What is the InChIKey of lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone?
The InChIKey is SLFVEJLGDKQXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29OP.Li.H/c1-13(2)16-11-18(14(3)4)21(19(12-16)15(5)6)22(23)17-9-7-8-10-20(17)24;;/h7-15H,24H2,1-6H3;;/q;+1;-1.
What are the key properties of lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone?
lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone has a molecular weight of 348.40 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone is sourced from PubChem (CID 173244480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).