C22H30LiOP — CID 173244480
lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone (PubChem CID 173244480) has the molecular formula C22H30LiOP and a molecular weight of 348.40 g/mol. Its IUPAC name is lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone.
| Compound Name | lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 173244480 |
| Molecular Formula | C22H30LiOP |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | lithium;hydride;(2-phosphanylphenyl)-[2,4,6-tri(propan-2-yl)phenyl]methanone |
| SMILES | CC(C)c1cc(C(C)C)c(C(=O)c2ccccc2P)c(C(C)C)c1.[H-].[Li+] |
| InChI | InChI=1S/C22H29OP.Li.H/c1-13(2)16-11-18(14(3)4)21(19(12-16)15(5)6)22(23)17-9-7-8-10-20(17)24;;/h7-15H,24H2,1-6H3;;/q;+1;-1 |
| InChIKey | SLFVEJLGDKQXCH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|