C22H20O6S2 — CID 54016782
benzenesulfonyl 2-(2,4,6-trimethylbenzoyl)benzenesulfonate (PubChem CID 54016782) has the molecular formula C22H20O6S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is benzenesulfonyl 2-(2,4,6-trimethylbenzoyl)benzenesulfonate.
| Compound Name | benzenesulfonyl 2-(2,4,6-trimethylbenzoyl)benzenesulfonate |
|---|---|
| PubChem CID | 54016782 |
| Molecular Formula | C22H20O6S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | benzenesulfonyl 2-(2,4,6-trimethylbenzoyl)benzenesulfonate |
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2S(=O)(=O)OS(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H20O6S2/c1-15-13-16(2)21(17(3)14-15)22(23)19-11-7-8-12-20(19)30(26,27)28-29(24,25)18-9-5-4-6-10-18/h4-14H,1-3H3 |
| InChIKey | KWEFUUAPQHIVHZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |