C58H63O9P — CID 158246107
[3,4-bis(2,6-dimethoxybenzoyl)-5-[phenyl(2,4,4-trimethylpentyl)phosphoryl]-2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 158246107) has the molecular formula C58H63O9P and a molecular weight of 935.11 g/mol. Its IUPAC name is [3,4-bis(2,6-dimethoxybenzoyl)-5-[phenyl(2,4,4-trimethylpentyl)phosphoryl]-2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [3,4-bis(2,6-dimethoxybenzoyl)-5-[phenyl(2,4,4-trimethylpentyl)phosphoryl]-2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 158246107 |
| Molecular Formula | C58H63O9P |
| Molecular Weight | 935.11 g/mol |
| Exact Mass | 934.42 |
| IUPAC Name | [3,4-bis(2,6-dimethoxybenzoyl)-5-[phenyl(2,4,4-trimethylpentyl)phosphoryl]-2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)c1c(P(=O)(CC(C)CC(C)(C)C)c2ccccc2)cc(C(=O)c2c(C)cc(C)cc2C)c(C(=O)c2c(C)cc(C)cc2C)c1C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C58H63O9P/c1-33-26-36(4)47(37(5)27-33)54(59)41-30-46(68(63,40-20-16-15-17-21-40)32-35(3)31-58(8,9)10)52(56(61)50-42(64-11)22-18-23-43(50)65-12)53(57(62)51-44(66-13)24-19-25-45(51)67-14)49(41)55(60)48-38(6)28-34(2)29-39(48)7/h15-30,35H,31-32H2,1-14H3 |
| InChIKey | GGDDIEUIKGSGST-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.11 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|