C21H25Cl2O2P — CID 18514057
(2,6-dichlorophenyl)-[phenyl(2,4,4-trimethylpentyl)phosphoryl]methanone (PubChem CID 18514057) has the molecular formula C21H25Cl2O2P and a molecular weight of 411.31 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-[phenyl(2,4,4-trimethylpentyl)phosphoryl]methanone.
| Compound Name | (2,6-dichlorophenyl)-[phenyl(2,4,4-trimethylpentyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 18514057 |
| Molecular Formula | C21H25Cl2O2P |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (2,6-dichlorophenyl)-[phenyl(2,4,4-trimethylpentyl)phosphoryl]methanone |
| SMILES | CC(CC(C)(C)C)CP(=O)(C(=O)c1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C21H25Cl2O2P/c1-15(13-21(2,3)4)14-26(25,16-9-6-5-7-10-16)20(24)19-17(22)11-8-12-18(19)23/h5-12,15H,13-14H2,1-4H3 |
| InChIKey | ILHWLVFMRYTOHL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|