C21H27O2P — CID 18513883
(4-tert-butyl-2,6-dimethylphenyl)-[ethyl(phenyl)phosphoryl]methanone (PubChem CID 18513883) has the molecular formula C21H27O2P and a molecular weight of 342.42 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)-[ethyl(phenyl)phosphoryl]methanone.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)-[ethyl(phenyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 18513883 |
| Molecular Formula | C21H27O2P |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)-[ethyl(phenyl)phosphoryl]methanone |
| SMILES | CCP(=O)(C(=O)c1c(C)cc(C(C)(C)C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C21H27O2P/c1-7-24(23,18-11-9-8-10-12-18)20(22)19-15(2)13-17(14-16(19)3)21(4,5)6/h8-14H,7H2,1-6H3 |
| InChIKey | QWKVVHWFYBFRLW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|