C28H39O3P — CID 22183425
[butyl-(2,6-diethylbenzoyl)phosphoryl]-(4-tert-butyl-2,6-dimethylphenyl)methanone (PubChem CID 22183425) has the molecular formula C28H39O3P and a molecular weight of 454.59 g/mol. Its IUPAC name is [butyl-(2,6-diethylbenzoyl)phosphoryl]-(4-tert-butyl-2,6-dimethylphenyl)methanone.
| Compound Name | [butyl-(2,6-diethylbenzoyl)phosphoryl]-(4-tert-butyl-2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 22183425 |
| Molecular Formula | C28H39O3P |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | [butyl-(2,6-diethylbenzoyl)phosphoryl]-(4-tert-butyl-2,6-dimethylphenyl)methanone |
| SMILES | CCCCP(=O)(C(=O)c1c(C)cc(C(C)(C)C)cc1C)C(=O)c1c(CC)cccc1CC |
| InChI | InChI=1S/C28H39O3P/c1-9-12-16-32(31,27(30)25-21(10-2)14-13-15-22(25)11-3)26(29)24-19(4)17-23(18-20(24)5)28(6,7)8/h13-15,17-18H,9-12,16H2,1-8H3 |
| InChIKey | HTLJBYXDUWEJRW-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|