C35H49O6PSi2 — CID 67952431
[3-[ethoxy-[ethoxy(dimethyl)silyl]oxy-phenylsilyl]propyl-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 67952431) has the molecular formula C35H49O6PSi2 and a molecular weight of 652.92 g/mol. Its IUPAC name is [3-[ethoxy-[ethoxy(dimethyl)silyl]oxy-phenylsilyl]propyl-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [3-[ethoxy-[ethoxy(dimethyl)silyl]oxy-phenylsilyl]propyl-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 67952431 |
| Molecular Formula | C35H49O6PSi2 |
| Molecular Weight | 652.92 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | [3-[ethoxy-[ethoxy(dimethyl)silyl]oxy-phenylsilyl]propyl-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCO[Si](C)(C)O[Si](CCCP(=O)(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C)(OCC)c1ccccc1 |
| InChI | InChI=1S/C35H49O6PSi2/c1-11-39-43(9,10)41-44(40-12-2,31-17-14-13-15-18-31)20-16-19-42(38,34(36)32-27(5)21-25(3)22-28(32)6)35(37)33-29(7)23-26(4)24-30(33)8/h13-15,17-18,21-24H,11-12,16,19-20H2,1-10H3 |
| InChIKey | HNRSFNDEUIDATN-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.92 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|