C26H40ClO3PSi2 — CID 159449240
[[[chloromethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone;ethene (PubChem CID 159449240) has the molecular formula C26H40ClO3PSi2 and a molecular weight of 523.20 g/mol. Its IUPAC name is [[[chloromethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone;ethene.
| Compound Name | [[[chloromethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone;ethene |
|---|---|
| PubChem CID | 159449240 |
| Molecular Formula | C26H40ClO3PSi2 |
| Molecular Weight | 523.20 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | [[[chloromethyl(dimethyl)silyl]oxy-dimethylsilyl]methyl-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone;ethene |
| SMILES | C=C.C=C.Cc1cc(C)c(C(=O)P(=O)(C[Si](C)(C)O[Si](C)(C)CCl)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H32ClO3PSi2.2C2H4/c1-17-13-18(2)21(19(3)14-17)22(24)27(25,20-11-9-8-10-12-20)16-29(6,7)26-28(4,5)15-23;2*1-2/h8-14H,15-16H2,1-7H3;2*1-2H2 |
| InChIKey | LTDPRKZLWUUNOW-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.20 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|