C22H27O6P — CID 22183748
[ethyl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 22183748) has the molecular formula C22H27O6P and a molecular weight of 418.43 g/mol. Its IUPAC name is [ethyl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [ethyl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 22183748 |
| Molecular Formula | C22H27O6P |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [ethyl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCP(=O)(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C22H27O6P/c1-8-29(25,21(23)19-14(3)9-13(2)10-15(19)4)22(24)20-17(27-6)11-16(26-5)12-18(20)28-7/h9-12H,8H2,1-7H3 |
| InChIKey | SDFPSZXKCFPNAW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|