C25H31O5P — CID 22183265
[cyclohexyl-(2,6-dimethoxybenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 22183265) has the molecular formula C25H31O5P and a molecular weight of 442.49 g/mol. Its IUPAC name is [cyclohexyl-(2,6-dimethoxybenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [cyclohexyl-(2,6-dimethoxybenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 22183265 |
| Molecular Formula | C25H31O5P |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [cyclohexyl-(2,6-dimethoxybenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)P(=O)(C(=O)c1c(C)cc(C)cc1C)C1CCCCC1 |
| InChI | InChI=1S/C25H31O5P/c1-16-14-17(2)22(18(3)15-16)24(26)31(28,19-10-7-6-8-11-19)25(27)23-20(29-4)12-9-13-21(23)30-5/h9,12-15,19H,6-8,10-11H2,1-5H3 |
| InChIKey | UBFZZVMUWPMOKV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|