About tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate
tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate (PubChem CID 174400565) has the molecular formula C22H33O4P
and a molecular weight of 392.48 g/mol. Its IUPAC name is tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate |
| PubChem CID | 174400565 |
| Molecular Formula | C22H33O4P |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(CC(=O)OC(C)(C)C)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C22H33O4P/c1-15-12-16(2)20(17(3)13-15)21(24)27(25,18-10-8-7-9-11-18)14-19(23)26-22(4,5)6/h12-13,18H,7-11,14H2,1-6H3 |
| InChIKey | QYRIRXLMCYFLSV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate?
The IUPAC name of tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate (CID 174400565) is tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate.
What is the SMILES notation for tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate?
The canonical SMILES for tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate is Cc1cc(C)c(C(=O)P(=O)(CC(=O)OC(C)(C)C)C2CCCCC2)c(C)c1.
What is the InChIKey of tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate?
The InChIKey is QYRIRXLMCYFLSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33O4P/c1-15-12-16(2)20(17(3)13-15)21(24)27(25,18-10-8-7-9-11-18)14-19(23)26-22(4,5)6/h12-13,18H,7-11,14H2,1-6H3.
What are the key properties of tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate?
tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate has a molecular weight of 392.48 g/mol, XLogP of 5.79, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[cyclohexyl-(2,4,6-trimethylbenzoyl)phosphoryl]acetate is sourced from PubChem (CID 174400565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).