C18H29O2P — CID 22183894
[tert-butyl(2-methylpropyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 22183894) has the molecular formula C18H29O2P and a molecular weight of 308.40 g/mol. Its IUPAC name is [tert-butyl(2-methylpropyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [tert-butyl(2-methylpropyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 22183894 |
| Molecular Formula | C18H29O2P |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | [tert-butyl(2-methylpropyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(CC(C)C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C18H29O2P/c1-12(2)11-21(20,18(6,7)8)17(19)16-14(4)9-13(3)10-15(16)5/h9-10,12H,11H2,1-8H3 |
| InChIKey | KXAXXCHDQPXAMW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|